2-Bromo-4-nitrotoluene structure
|
Common Name | 2-Bromo-4-nitrotoluene | ||
|---|---|---|---|---|
| CAS Number | 7745-93-9 | Molecular Weight | 216.032 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 280.4±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H6BrNO2 | Melting Point | 76-77 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 123.4±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Bromo-4-nitrotoluene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 280.4±20.0 °C at 760 mmHg |
| Melting Point | 76-77 °C(lit.) |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.032 |
| Flash Point | 123.4±21.8 °C |
| Exact Mass | 214.958176 |
| PSA | 45.82000 |
| LogP | 2.98 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | XFZFJQHXWJIBQV-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])cc1Br |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Packaging Group | I; II; III |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-Bromo-1-methyl-4-nitrobenzene |
| EINECS 231-809-9 |
| 2-Br-1-me-4-nitrobenzene |
| 4-nitro-2-bromo toluene |
| 2-Methyl-5-nitrophenyl bromide |
| 2-bromo-4-nitro-toluene |
| Toluene,2-bromo-4-nitro |
| MFCD00007195 |
| 3-Bromo-4-methylnitrobenzene |
| 1-Bromo-2-methyl-5-nitrobenzene |
| 2-Bromo-4-nitrotoluene |
| 3-Bromo-4-methyl-1-nitrobenzene |