4-nitro-2-phenyl-1H-indole structure
|
Common Name | 4-nitro-2-phenyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 7746-36-3 | Molecular Weight | 238.24100 | |
| Density | 1.33g/cm3 | Boiling Point | 477.5ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.6ºC | |
| Name | 4-nitro-2-phenyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 477.5ºC at 760 mmHg |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.24100 |
| Flash Point | 242.6ºC |
| Exact Mass | 238.07400 |
| PSA | 61.61000 |
| LogP | 4.26630 |
| Index of Refraction | 1.706 |
| InChIKey | PQDVHCLDYBFYSR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2[nH]c(-c3ccccc3)cc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole,4-nitro-2-phenyl |
| 4-Nitro-2-phenylindole |
| 2-Phenyl-4-nitro-indol |
| 2-phenyl-4-nitroindole |