7-Methoxy-4-oxo-1,4-dihydroquinoline-2-carboxylic acid structure
|
Common Name | 7-Methoxy-4-oxo-1,4-dihydroquinoline-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 77474-33-0 | Molecular Weight | 219.193 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 407.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.0±28.7 °C | |
| Name | 7-methoxy-4-oxo-1H-quinoline-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.1±45.0 °C at 760 mmHg |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.193 |
| Flash Point | 200.0±28.7 °C |
| Exact Mass | 219.053162 |
| PSA | 79.39000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | JUQPPCMGDXBUFQ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)cc(C(=O)O)[nH]c2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~%
7-Methoxy-4-oxo... CAS#:77474-33-0 |
| Literature: US2005/209274 A1, ; Page/Page column 31 ; US 20050209274 A1 |
|
~%
7-Methoxy-4-oxo... CAS#:77474-33-0 |
| Literature: Synthesis, , # 2 p. 150 - 152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Quinolinecarboxylic acid, 1,4-dihydro-7-methoxy-4-oxo- |
| 7-Methoxy-4-oxo-1,4-dihydroquinoline-2-carboxylic acid |
| 7-Methoxy-4-oxo-1,4-dihydro-2-quinolinecarboxylic acid |
| 4-hydroxy-7-methoxyquinoline-2-carboxylic acid |
| 4-Hydroxy-7-methoxy-2-quinolinecarboxylic acid |