3,3,4,4,5,5,6,6-octafluorocyclohexene
3,3,4,4,5,5,6,6-octafluorocyclohexene structure
|
Common Name | 3,3,4,4,5,5,6,6-octafluorocyclohexene | ||
|---|---|---|---|---|
| CAS Number | 775-40-6 | Molecular Weight | 226.06700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3,3,4,4,5,5,6,6-Octafluorocyclohexene (CAS号：775-40-6), molecular formula C6H2F8, molecular weight 226.06700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3,4,4,5,5,6,6-octafluorocyclohexene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H2F8 |
|---|---|
| Molecular Weight | 226.06700 |
| Exact Mass | 226.00300 |
| LogP | 3.09740 |
| InChIKey | JSIJIGNXOVSJFX-UHFFFAOYSA-N |
| SMILES | FC1(F)C=CC(F)(F)C(F)(F)C1(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:2367-86-4
CAS#:308-24-7
CAS#:355-75-9
CAS#:777-97-9
CAS#:355-68-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| CYCLOHEXENE,3,3,4,4,5,5,6,6-OCTAFLUORO |
| 3,3,4,4,5,5,6,6-Octafluoro-1-cyclohexene |
| 1H,2H-Octafluorocyclohexene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3,3,4,4,5,5,6,6-octafluorocyclohexene have? |
| A: English synonyms of 3,3,4,4,5,5,6,6-octafluorocyclohexene: CYCLOHEXENE,3,3,4,4,5,5,6,6-OCTAFLUORO, 3,3,4,4,5,5,6,6-Octafluoro-1-cyclohexene, 1H,2H-Octafluorocyclohexene. |
| Q: What is the LogP of 3,3,4,4,5,5,6,6-octafluorocyclohexene? |
| A: LogP of 3,3,4,4,5,5,6,6-octafluorocyclohexene is 3.09740. |
| Q: What is the molecular weight of 3,3,4,4,5,5,6,6-octafluorocyclohexene? |
| A: Molecular weight of 3,3,4,4,5,5,6,6-octafluorocyclohexene is 226.06700. |
| Q: What are the downstream products of 3,3,4,4,5,5,6,6-octafluorocyclohexene? |
| A: Related downstream products(CAS) of 3,3,4,4,5,5,6,6-octafluorocyclohexene: 2367-86-4;308-24-7;355-75-9;777-97-9;355-68-0. |
| Q: What is the InChIKey of 3,3,4,4,5,5,6,6-octafluorocyclohexene? |
| A: InChIKey of 3,3,4,4,5,5,6,6-octafluorocyclohexene is JSIJIGNXOVSJFX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3,3,4,4,5,5,6,6-octafluorocyclohexene? |
| A: Molecular formula of 3,3,4,4,5,5,6,6-octafluorocyclohexene is C6H2F8. |
| Q: What is the Chinese name of 775-40-6? |
| A: Chinese name of 775-40-6 is 775-40-6. |
| Q: What is the CAS number of 3,3,4,4,5,5,6,6-octafluorocyclohexene? |
| A: CAS number of 3,3,4,4,5,5,6,6-octafluorocyclohexene is 775-40-6. |
| Q: What is the English name of 3,3,4,4,5,5,6,6-octafluorocyclohexene? |
| A: The English name of 3,3,4,4,5,5,6,6-octafluorocyclohexene is 3,3,4,4,5,5,6,6-octafluorocyclohexene. |
| Q: What is the SMILES notation of 3,3,4,4,5,5,6,6-octafluorocyclohexene? |
| A: SMILES notation of 3,3,4,4,5,5,6,6-octafluorocyclohexene is FC1(F)C=CC(F)(F)C(F)(F)C1(F)F. |