perfluorocyclohexane
perfluorocyclohexane structure
|
Common Name | perfluorocyclohexane | ||
|---|---|---|---|---|
| CAS Number | 355-68-0 | Molecular Weight | 300.04500 | |
| Density | 1.684 | Boiling Point | 59-60°C | |
| Molecular Formula | C6F12 | Melting Point | 51 °C (subl.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.684 |
|---|---|
| Boiling Point | 59-60°C |
| Melting Point | 51 °C (subl.)(lit.) |
| Molecular Formula | C6F12 |
| Molecular Weight | 300.04500 |
| Exact Mass | 299.98100 |
| LogP | 3.81180 |
| Index of Refraction | 1.2685 |
| InChIKey | RKIMETXDACNTIE-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S23-S24/25 |
| WGK Germany | 3 |
| HS Code | 2903890090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 4 | |
CAS#:71-43-2
CAS#:392-56-3
CAS#:2367-86-4
CAS#:110-82-7
CAS#:775-40-6
CAS#:653-37-2
CAS#:91-15-6
CAS#:626-17-5
CAS#:91-22-5
CAS#:327-54-8
CAS#:769-39-1
CAS#:652-18-6
CAS#:602-94-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dodecafluorocyclohexane |
| Cyclohexane,dodecafluoro |
| EINECS 206-591-3 |
| MFCD00003821 |
| Dodekafluorcyclohexan |
| perfluorocyclo-hexane |
| Dodecafluor-cyclohexan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: Molecular formula of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane is C6F12. |
| Q: What is the boiling point of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: Boiling point of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane is 59-60°C. |
| Q: What is the English name of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: The English name of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane. |
| Q: What is the melting point of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: Melting point of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane is 51 °C (subl.)(lit.). |
| Q: What is the molecular weight of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: Molecular weight of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane is 300.04500. |
| Q: What is the SMILES notation of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: SMILES notation of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane is FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F. |
| Q: What are the downstream products of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: Related downstream products(CAS) of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane: 327-54-8;769-39-1;652-18-6;602-94-8. |
| Q: What are the upstream materials of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: Related upstream materials(CAS) of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane: 71-43-2;392-56-3;2367-86-4;110-82-7;775-40-6;653-37-2;91-15-6;626-17-5;91-22-5. |
| Q: What is the LogP of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: LogP of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane is 3.81180. |
| Q: What is the CAS number of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane? |
| A: CAS number of 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane is 355-68-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |