Phenol, 4,4',4''-(1,3,5-triazine-2,4,6-triyl)tris- structure
|
Common Name | Phenol, 4,4',4''-(1,3,5-triazine-2,4,6-triyl)tris- | ||
|---|---|---|---|---|
| CAS Number | 7753-13-1 | Molecular Weight | 357.36200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4,6-bis(4-oxocyclohexa-2,5-dien-1-ylidene)-1,3,5-triazinan-2-ylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H15N3O3 |
|---|---|
| Molecular Weight | 357.36200 |
| Exact Mass | 357.11100 |
| PSA | 98.58000 |
| LogP | 0.05160 |
| InChIKey | GPSBTCCYBACYRE-UHFFFAOYSA-N |
| SMILES | Oc1ccc(-c2nc(-c3ccc(O)cc3)nc(-c3ccc(O)cc3)n2)cc1 |
| Hazard Codes | Xn |
|---|
|
~90%
Phenol, 4,4',4'... CAS#:7753-13-1 |
| Literature: Kotha, Sambasivarao; Kashinath, Dhurke; Lopus, Manu; Panda, Dulal Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2009 , vol. 48, # 12 p. 1766 - 1770 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| MFCD32710221 |