4-Nitro-1-naphthalenamine structure
|
Common Name | 4-Nitro-1-naphthalenamine | ||
|---|---|---|---|---|
| CAS Number | 776-34-1 | Molecular Weight | 188.183 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 419.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | 190-193 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 207.2±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitro-1-naphthylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.0±25.0 °C at 760 mmHg |
| Melting Point | 190-193 °C(lit.) |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.183 |
| Flash Point | 207.2±23.2 °C |
| Exact Mass | 188.058578 |
| PSA | 71.84000 |
| LogP | 2.62 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.729 |
| InChIKey | BVPJPRYNQHAOPQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])c2ccccc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | QM4370000 |
|
Does P-glycoprotein contribute to amphotericin B epithelial transport in Caco-2 cells?
Drug Dev. Ind. Pharm. 41 , 1130-6, (2015) Amphotericin B (AmB) is a highly efficacious therapeutic for invasive fungal infections and protozoal diseases. Increasing prevalence of these conditions warrants the development of an oral AmB formul... |
|
Name: Mixed inhibition of human recombinant cathepsin B endopeptidase activity using Z-Arg-...
Source: ChEMBL
Target: Cathepsin B
External Id: CHEMBL2321267
|
|
Name: Mixed inhibition of human recombinant cathepsin B endopeptidase activity using Z-Arg-...
Source: ChEMBL
Target: Cathepsin B
External Id: CHEMBL2321266
|
|
Name: Noncompetitive inhibition of human recombinant cathepsin B exopeptidase activity usin...
Source: ChEMBL
Target: Cathepsin B
External Id: CHEMBL2321264
|
|
Name: Chan-Lam from Article : "Open science discovery of potent noncovalent SARS-CoV-2 main...
Source: BindingDB
Target: N/A
External Id: BindingDB_11549_1
|
| EINECS 212-277-7 |
| 4-Nitro-1-naphthalenamine |
| 4-nitronaphthalen-1-amine |
| MFCD00004026 |