4,15-Bis(acetyloxy)-12,13-epoxy-3-hydroxytrichothec-9-en-8-one (3alpha,4beta)
4,15-Bis(acetyloxy)-12,13-epoxy-3-hydroxytrichothec-9-en-8-one (3alpha,4beta) structure
|
Common Name | 4,15-Bis(acetyloxy)-12,13-epoxy-3-hydroxytrichothec-9-en-8-one (3alpha,4beta) | ||
|---|---|---|---|---|
| CAS Number | 77620-47-4 | Molecular Weight | 380.38900 | |
| Density | 1.38g/cm3 | Boiling Point | 519.7ºC at 760 mmHg | |
| Molecular Formula | C19H24O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8ºC | |
Summary: 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one (CAS: 77620-47-4), molecular formula C19H24O8, molecular weight 380.38900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 519.7ºC at 760 mmHg |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.38900 |
| Flash Point | 182.8ºC |
| Exact Mass | 380.14700 |
| PSA | 111.66000 |
| LogP | 0.30390 |
| Index of Refraction | 1.569 |
| InChIKey | FAQMCKSIBZGZIB-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC12CC(=O)C(C)=CC1OC1C(O)C(OC(C)=O)C2(C)C12CO2 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:36519-25-2
CAS#:81331-40-0
CAS#:81331-42-2
CAS#:81331-43-3![Trichothec-9-ene-3,8-dione,15-(acetyloxy)-12,13-epoxy-4-[(2-methyl-1-oxo-2-propenyl)oxy]-, (4b)- (9CI) structure](https://image.chemsrc.com/caspic/210/77620-58-7.png)
CAS#:77620-58-7
CAS#:77620-59-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 8-oxo-diacetoxyscirpenol |
| 4,15-Diacetyl-7-deoxynivalenol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one have? |
| A: English synonyms of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one: 8-oxo-diacetoxyscirpenol, 4,15-Diacetyl-7-deoxynivalenol. |
| Q: What are the downstream products of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one? |
| A: Related downstream products(CAS) of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one: 36519-25-2;81331-40-0;81331-42-2;81331-43-3;77620-58-7;77620-59-8. |
| Q: What is the polar surface area (PSA) of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one? |
| A: Polar surface area (PSA) of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one is 111.66000. |
| Q: What is the CAS number of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one? |
| A: CAS number of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one is 77620-47-4. |
| Q: What is the boiling point of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one? |
| A: Boiling point of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one is 519.7ºC at 760 mmHg. |
| Q: What is the molecular formula of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one? |
| A: Molecular formula of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one is C19H24O8. |
| Q: What is the molecular weight of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one? |
| A: Molecular weight of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one is 380.38900. |
| Q: What is the English name of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one? |
| A: The English name of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one is 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one. |
| Q: What is the LogP of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one? |
| A: LogP of 4β,15-Diacetoxy-3α-hydroxy-12,13-epoxytrichothec-9-en-8-one is 0.30390. |
| Q: What is the Chinese name of 77620-47-4? |
| A: Chinese name of 77620-47-4 is 77620-47-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |