4-tert-butoxycarbonylamino-1-methyl-1h-pyrrole-2-carboxylic acid structure
|
Common Name | 4-tert-butoxycarbonylamino-1-methyl-1h-pyrrole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 77716-11-1 | Molecular Weight | 226.229 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 348.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H14N2O4 | Melting Point | 156-160ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | 164.4±23.7 °C | |
| Name | 1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 348.2±27.0 °C at 760 mmHg |
| Melting Point | 156-160ºC (dec.) |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.229 |
| Flash Point | 164.4±23.7 °C |
| Exact Mass | 226.095352 |
| PSA | 80.56000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | GOLAEMFBWAIGRX-UHFFFAOYSA-N |
| SMILES | Cn1cc(NC(=O)OC(C)(C)C)cc1C(=O)O |
| Storage condition | -15°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
E.E. Baird, P.B. Dervan
J. Am. Chem. Soc. 118 , 6141, (1996)
|
|
|
Recognition of the four Watson-Crick base pairs in the DNA minor groove by synthetic ligands.
Nature 391 , 468, (1998) The design of synthetic ligands that read the information stored in the DNA double helix has been a long-standing goal at the interface of chemistry and biology. Cell-permeable small molecules that ta... |
| 4-[(tert-butoxy)carbonylamino]-1-methylpyrrole-2-carboxylic acid |
| 1H-Pyrrole-2-carboxylic acid, 1-methyl-4-[[(1-methylethoxy)carbonyl]amino]- |
| 4-amino-1-methyl-1h-pyrrole-2-carboxylic acid,4-boc protected |
| 4-[(tert-Butoxycarbonyl)amino]-2-carboxy-1-methyl-1H-pyrrole |
| boc-py-oh |
| 4-tert-Butoxycarbonylamino-1-methyl-1H-pyrrole-2-carboxylic acid |
| 4-(Boc-amino)-1-methylpyrrole-2-carboxylic acid |
| (tert-butoxycarbonyl)amino>-1-methylpyrrole-2-carboxylic acid |
| 4-[[(tert-Butyloxy)carbonyl]-amino]-1-methylpyrrole-2-carboxylic acid |
| MFCD02094544 |
| (tert-Butyloxy)carbonyl>-1-methylpyrrole-2-carboxylic Acid |
| 4-[(tert-butoxycarbonyl)amino]-N-methyl-1H-imidazole-2-carboxylate |
| 4-[(Isopropoxycarbonyl)amino]-1-methyl-1H-pyrrole-2-carboxylic acid |
| 4-(Boc-amino)-1-methyl-1H-pyrrole-2-carboxylic acid |