Acetamide,N-[4-hydroxy-3-[(4-phenyl-1-piperazinyl)methyl]phenyl]- structure
|
Common Name | Acetamide,N-[4-hydroxy-3-[(4-phenyl-1-piperazinyl)methyl]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 77726-10-4 | Molecular Weight | 325.40500 | |
| Density | 1.239g/cm3 | Boiling Point | 552.2ºC at 760 mmHg | |
| Molecular Formula | C19H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.8ºC | |
| Name | N-[4-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]phenyl]acetamide |
|---|
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 552.2ºC at 760 mmHg |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.40500 |
| Flash Point | 287.8ºC |
| Exact Mass | 325.17900 |
| PSA | 55.81000 |
| LogP | 2.74870 |
| Index of Refraction | 1.646 |
| InChIKey | QUKJEHJRISSJIB-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(O)c(CN2CCN(c3ccccc3)CC2)c1 |
|
~50%
Acetamide,N-[4-... CAS#:77726-10-4 |
| Literature: Agrawal, V. K.; Sharma, Satyavan; Iyer, R. N.; Chatterjee, R. K.; Sen, A. B. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 12 p. 1084 - 1087 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |