Candidone structure
|
Common Name | Candidone | ||
|---|---|---|---|---|
| CAS Number | 77727-18-5 | Molecular Weight | 352.42 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 520.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H24O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 227.1±30.2 °C | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of CandidoneDescription Natural product derived from plant source.} |
| Name | Candidone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 520.0±50.0 °C at 760 mmHg |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.42 |
| Flash Point | 227.1±30.2 °C |
| Exact Mass | 352.167450 |
| LogP | 5.64 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | JYESOAFLKFHYHP-SFHVURJKSA-N |
| SMILES | COc1cc(OC)c2c(c1CC=C(C)C)OC(c1ccccc1)CC2=O |
| MFCD24849324 |