S-(4-nitrophenyl) 4-methoxybenzenecarbothioate structure
|
Common Name | S-(4-nitrophenyl) 4-methoxybenzenecarbothioate | ||
|---|---|---|---|---|
| CAS Number | 77750-05-1 | Molecular Weight | 289.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(4-nitrophenyl) 4-methoxybenzenecarbothioate |
|---|
| Molecular Formula | C14H11NO4S |
|---|---|
| Molecular Weight | 289.30600 |
| Exact Mass | 289.04100 |
| PSA | 97.42000 |
| LogP | 4.05910 |
| InChIKey | PSIXLVBMDQEBIJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Sc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
S-(4-nitropheny... CAS#:77750-05-1 |
| Literature: Cilento Journal of the American Chemical Society, 1953 , vol. 75, p. 3748,3750 Experientia, 1952 , vol. 8, p. 421 |