S-(4-nitrophenyl) 4-nitrobenzenecarbothioate structure
|
Common Name | S-(4-nitrophenyl) 4-nitrobenzenecarbothioate | ||
|---|---|---|---|---|
| CAS Number | 69737-96-8 | Molecular Weight | 304.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(4-nitrophenyl) 4-nitrobenzenecarbothioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8N2O5S |
|---|---|
| Molecular Weight | 304.27800 |
| Exact Mass | 304.01500 |
| PSA | 134.01000 |
| LogP | 4.48190 |
| InChIKey | HOIFMMNMBSARSX-UHFFFAOYSA-N |
| SMILES | O=C(Sc1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
S-(4-nitropheny... CAS#:69737-96-8 |
| Literature: Cilento Journal of the American Chemical Society, 1953 , vol. 75, p. 3748,3750 Experientia, 1952 , vol. 8, p. 421 |
|
~%
S-(4-nitropheny... CAS#:69737-96-8 |
| Literature: Lee, Ikchoon; Shim, Chang Sub; Lee, Hai Whang Journal of Chemical Research, Miniprint, 1992 , # 3 p. 769 - 793 |
| S-4-nitrophenyl 4-nitrothiobenzoate |
| 4-Nitro-monothiobenzoesaeure-<4-nitro-phenylester> |
| 4-nitrophenyl 4-nitrothiolbenzoate |
| S-(p-nitrophenyl) p-nitrothiobenzoate |
| 4-Nitro-thiobenzoesaeure-S-(4-nitro-phenylester) |
| 4-nitro-thiobenzoic acid S-(4-nitro-phenyl ester) |
| Benzenecarbothioic acid,4-nitro-,S-(4-nitrophenyl) ester |