N-(3-hydroxy-1-adamantyl)acetamide structure
|
Common Name | N-(3-hydroxy-1-adamantyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 778-10-9 | Molecular Weight | 209.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-hydroxy-1-adamantyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19NO2 |
|---|---|
| Molecular Weight | 209.28500 |
| Exact Mass | 209.14200 |
| PSA | 52.82000 |
| LogP | 2.04650 |
| InChIKey | QGQQCWHALQYFDK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC12CC3CC(CC(O)(C3)C1)C2 |
| HS Code | 2924299090 |
|---|
|
~95%
N-(3-hydroxy-1-... CAS#:778-10-9 |
| Literature: Daicel Chemical Industries, Ltd.; Ishii, Yasutaka Patent: EP915077 A1, 1999 ; |
|
~78%
N-(3-hydroxy-1-... CAS#:778-10-9 |
| Literature: GLENMARK PHARMACEUTICALS S.A. Patent: WO2006/90244 A1, 2006 ; Location in patent: Page/Page column 54 ; WO 2006/090244 A1 |
|
~20%
N-(3-hydroxy-1-... CAS#:778-10-9 |
| Literature: Farooq, Afgan; Hanson, James R. Journal of Chemical Research, Synopses, 1995 , # 4 p. 150 - 151 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 1-Acetamino-3-hydroxy-adamantan |
| CCG-6915 |
| N-Acetyl-1-adamantanamin-3-ol |
| 1-acetylamino-3-adamantanol |
| 1-Acetamidoadamantan-3-ol |