Methyl 6-oxo-1-phenyl-1,6-dihydropyridine-3-carboxylate structure
|
Common Name | Methyl 6-oxo-1-phenyl-1,6-dihydropyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 77837-09-3 | Molecular Weight | 229.231 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 370.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | 160-162°C | |
| MSDS | N/A | Flash Point | 177.6±27.9 °C | |
| Name | 5-methyl-6-oxo-1-phenylpyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.0±42.0 °C at 760 mmHg |
| Melting Point | 160-162°C |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.231 |
| Flash Point | 177.6±27.9 °C |
| Exact Mass | 229.073898 |
| PSA | 48.30000 |
| LogP | 0.77 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | RJBSPLUQQNNULO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(=O)n(-c2ccccc2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~57%
Methyl 6-oxo-1-... CAS#:77837-09-3 |
| Literature: AUSPEX PHARMACEUTICALS, INC.; ZHANG, Chengzhi; SOMMERS, Andreas Patent: WO2012/122165 A2, 2012 ; Location in patent: Page/Page column 63 ; |
|
~73%
Methyl 6-oxo-1-... CAS#:77837-09-3 |
| Literature: Zhu, Weixing; Shen, Jie; Li, Qianbin; Pei, Qi; Chen, Jun; Chen, Zhuo; Liu, Zhaoqian; Hu, Gaoyun Archiv der Pharmazie, 2013 , vol. 346, # 9 p. 654 - 666 |
|
~%
Methyl 6-oxo-1-... CAS#:77837-09-3 |
| Literature: WO2012/122165 A2, ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 1-phenyl-6-keto-1,6-dihydronicotinate |
| methyl 6-oxo-1-phenyl-1,6-dihydropyridine-3-carboxylate |
| METHYL 5-CARBOXY-N-PHENYL-2(1H)-PYRIDONE |
| N-Phenyl-pyridon-(2)-carbonsaeure-(5)-methylester |
| 6-oxo-1-phenyl-1,6-dihydro-pyridine-3-carboxylic acid methyl ester |
| 3-Pyridinecarboxylic acid, 1,6-dihydro-6-oxo-1-phenyl-, methyl ester |
| 6-Oxo-1-phenyl-1,6-dihydro-pyridin-3-carbonsaeure-methylester |
| Methyl 6-oxo-1-phenyl-1,6-dihydro-3-pyridinecarboxylate |
| 3-Pyridinecarboxylicacid,1,6-dihydro-6-oxo-1-phenyl-,methyl ester |