4,7-Epoxyisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-4,7-dimethyl
4,7-Epoxyisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-4,7-dimethyl structure
|
Common Name | 4,7-Epoxyisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-4,7-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 77880-59-2 | Molecular Weight | 194.18400 | |
| Density | 1.414g/cm3 | Boiling Point | 329.8ºC at 760 mmHg | |
| Molecular Formula | C10H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 329.8ºC at 760 mmHg |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.18400 |
| Flash Point | 148ºC |
| Exact Mass | 194.05800 |
| PSA | 52.60000 |
| LogP | 0.41960 |
| Index of Refraction | 1.573 |
| InChIKey | GGKZQSNCAIFSGT-UHFFFAOYSA-N |
| SMILES | CC12C=CC(C)(O1)C1C(=O)OC(=O)C12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
4,7-Epoxyisoben... CAS#:77880-59-2 |
| Literature: Kitamura, Chitoshi; Naito, Takao; Yoneda, Akio; Kawase, Takeshi; Komatsu, Toshiki Chemistry Letters, 2010 , vol. 39, # 7 p. 771 - 773 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 7 | |
CAS#:15540-88-2
CAS#:106-42-3
CAS#:110568-66-6
CAS#:944-38-7
CAS#:5463-50-3![[2-(hydroxymethyl)-3,6-dimethylphenyl]methanol structure](https://image.chemsrc.com/caspic/470/38108-81-5.png)
CAS#:38108-81-5
CAS#:38108-82-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-Dimethyl-7-oxa-norborn-5-en-2,3-dicarbonsaeure-anhydrid |
| 1,4-dimethyl-7-oxa-norborn-5-ene-2,3-dicarboxylic acid-anhydride |
| 1,4-Epoxy-1,2,3,4-tetrahydro-1,4-dimethylphthalsaeureanhydrid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride? |
| A: Molecular formula of 1,4-dimethyl-7-oxabicyclohept-5-ene-2,3-dicarboxylic anhydride is C10H10O4. |
| Q: What is the Chinese name of 77880-59-2? |
| A: Chinese name of 77880-59-2 is 77880-59-2. |
| Q: What is the SMILES notation of 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride? |
| A: SMILES notation of 1,4-dimethyl-7-oxabicyclohept-5-ene-2,3-dicarboxylic anhydride is CC12C=CC(C)(O1)C1C(=O)OC(=O)C12. |
| Q: What is the molecular weight of 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride? |
| A: Molecular weight of 1,4-dimethyl-7-oxabicyclohept-5-ene-2,3-dicarboxylic anhydride is 194.18400. |
| Q: What English synonyms does 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride have? |
| A: English synonyms of 1,4-dimethyl-7-oxabicyclohept-5-ene-2,3-dicarboxylic anhydride: 1,4-Dimethyl-7-oxa-norborn-5-en-2,3-dicarbonsaeure-anhydrid, 1,4-dimethyl-7-oxa-norborn-5-ene-2,3-dicarboxylic acid-anhydride, 1,4-Epoxy-1,2,3,4-tetrahydro-1,4-dimethylphthalsaeureanhydrid. |
| Q: What are the upstream materials of 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride? |
| A: Related upstream materials(CAS) of 1,4-dimethyl-7-oxabicyclohept-5-ene-2,3-dicarboxylic anhydride: 625-86-5;108-31-6. |
| Q: What is the LogP of 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride? |
| A: LogP of 1,4-dimethyl-7-oxabicyclohept-5-ene-2,3-dicarboxylic anhydride is 0.41960. |
| Q: What is the polar surface area (PSA) of 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride? |
| A: Polar surface area (PSA) of 1,4-dimethyl-7-oxabicyclohept-5-ene-2,3-dicarboxylic anhydride is 52.60000. |
| Q: What is the InChIKey of 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride? |
| A: InChIKey of 1,4-dimethyl-7-oxabicyclohept-5-ene-2,3-dicarboxylic anhydride is GGKZQSNCAIFSGT-UHFFFAOYSA-N. |
| Q: What is the boiling point of 1,4-dimethyl-7-oxabicyclo<2.2.1>hept-5-ene-2,3-dicarboxylic anhydride? |
| A: Boiling point of 1,4-dimethyl-7-oxabicyclohept-5-ene-2,3-dicarboxylic anhydride is 329.8ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |