Thymidine, 5'-[bis(2,2-dimethyl-1-aziridinyl)phosphinate] (9CI) structure
|
Common Name | Thymidine, 5'-[bis(2,2-dimethyl-1-aziridinyl)phosphinate] (9CI) | ||
|---|---|---|---|---|
| CAS Number | 77887-10-6 | Molecular Weight | 428.42000 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H29N4O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[5-[bis(2,2-dimethylaziridin-1-yl)phosphoryloxymethyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Molecular Formula | C18H29N4O6P |
| Molecular Weight | 428.42000 |
| Exact Mass | 428.18200 |
| PSA | 126.45000 |
| LogP | 0.68230 |
| Index of Refraction | 1.607 |
| InChIKey | GBGGASNAWLREPF-UHFFFAOYSA-N |
| SMILES | Cc1cn(C2CC(O)C(COP(=O)(N3CC3(C)C)N3CC3(C)C)O2)c(=O)[nH]c1=O |
|
~55%
Thymidine, 5'-[... CAS#:77887-10-6 |
| Literature: Hsiao; Bardos Journal of Medicinal Chemistry, 1981 , vol. 24, # 7 p. 887 - 889 |
|
~%
Thymidine, 5'-[... CAS#:77887-10-6 |
| Literature: Hsiao; Bardos Journal of Medicinal Chemistry, 1981 , vol. 24, # 7 p. 887 - 889 |
|
~%
Thymidine, 5'-[... CAS#:77887-10-6 |
| Literature: Hsiao; Bardos Journal of Medicinal Chemistry, 1981 , vol. 24, # 7 p. 887 - 889 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |