3'-O-Ac-dT structure
|
Common Name | 3'-O-Ac-dT | ||
|---|---|---|---|---|
| CAS Number | 21090-30-2 | Molecular Weight | 284.27 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3'-O-Ac-dT3'-O-Acetylthymidine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 3'-acetylthymidine |
|---|---|
| Synonym | More Synonyms |
| Description | 3'-O-Acetylthymidine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.42g/cm3 |
|---|---|
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 |
| Exact Mass | 284.10100 |
| PSA | 110.62000 |
| Index of Refraction | 1.576 |
| InChIKey | IRFKBRPHBYCMQU-UTLUCORTSA-N |
| SMILES | CC(=O)OC1CC(n2cc(C)c(=O)[nH]c2=O)OC1CO |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| MFCD00056059 |
| 3'-O-ACETYLTHYMIDINE |
| Thymidine 3'-acetate |
| 3'-O-acethyl thymidine |
| 3'-O-acetyl-2'-deoxythyMidine |
| 3'-O-Ac-thymidine |
| 3'-acetatethyMidine |
| 3'-O-Ac-dT |