2-ACETYLBIPHENYLENE
2-ACETYLBIPHENYLENE structure
|
Common Name | 2-ACETYLBIPHENYLENE | ||
|---|---|---|---|---|
| CAS Number | 779-26-0 | Molecular Weight | 194.22900 | |
| Density | 1.218g/cm3 | Boiling Point | 338.9ºC at 760 mmHg | |
| Molecular Formula | C14H10O | Melting Point | 137-139ºC(lit.) | |
| MSDS | N/A | Flash Point | 147.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-biphenylen-2-ylethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 338.9ºC at 760 mmHg |
| Melting Point | 137-139ºC(lit.) |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.22900 |
| Flash Point | 147.9ºC |
| Exact Mass | 194.07300 |
| PSA | 17.07000 |
| LogP | 3.53660 |
| Index of Refraction | 1.745 |
| InChIKey | MBOITOZRTPXJIS-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)-c1ccccc1-2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
2-ACETYLBIPHENYLENE CAS#:779-26-0 |
| Literature: Larkem, A.; Larkem, H. Egyptian Journal of Chemistry, 1999 , vol. 42, # 5 p. 481 - 490 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:93103-69-6
CAS#:55716-75-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Biphenylen-2-yl-aethanon |
| 2-Acetylbiphenylene |
| 1-biphenylen-2-yl-ethanone |
| 2-Acetyl-biphenylen |
| MFCD00003559 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1-biphenylen-2-ylethanone? |
| A: Related downstream products(CAS) of 1-biphenylen-2-ylethanone: 93103-69-6;55716-75-1. |
| Q: What is the CAS number of 1-biphenylen-2-ylethanone? |
| A: CAS number of 1-biphenylen-2-ylethanone is 779-26-0. |
| Q: What is the InChIKey of 1-biphenylen-2-ylethanone? |
| A: InChIKey of 1-biphenylen-2-ylethanone is MBOITOZRTPXJIS-UHFFFAOYSA-N. |
| Q: What is the melting point of 1-biphenylen-2-ylethanone? |
| A: Melting point of 1-biphenylen-2-ylethanone is 137-139ºC(lit.). |
| Q: What is the molecular formula of 1-biphenylen-2-ylethanone? |
| A: Molecular formula of 1-biphenylen-2-ylethanone is C14H10O. |
| Q: What is the polar surface area (PSA) of 1-biphenylen-2-ylethanone? |
| A: Polar surface area (PSA) of 1-biphenylen-2-ylethanone is 17.07000. |
| Q: What is the English name of 1-biphenylen-2-ylethanone? |
| A: The English name of 1-biphenylen-2-ylethanone is 1-biphenylen-2-ylethanone. |
| Q: What is the boiling point of 1-biphenylen-2-ylethanone? |
| A: Boiling point of 1-biphenylen-2-ylethanone is 338.9ºC at 760 mmHg. |
| Q: What is the SMILES notation of 1-biphenylen-2-ylethanone? |
| A: SMILES notation of 1-biphenylen-2-ylethanone is CC(=O)c1ccc2c(c1)-c1ccccc1-2. |
| Q: What English synonyms does 1-biphenylen-2-ylethanone have? |
| A: English synonyms of 1-biphenylen-2-ylethanone: 1-Biphenylen-2-yl-aethanon, 2-Acetylbiphenylene, 1-biphenylen-2-yl-ethanone, 2-Acetyl-biphenylen, MFCD00003559. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |