1,1,1,3,5,5,5-HEPTAFLUOROPENTANE-2,4-DIONE structure
|
Common Name | 1,1,1,3,5,5,5-HEPTAFLUOROPENTANE-2,4-DIONE | ||
|---|---|---|---|---|
| CAS Number | 77968-17-3 | Molecular Weight | 226.04900 | |
| Density | 1.57g/cm3 | Boiling Point | 70-72°C | |
| Molecular Formula | C5HF7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 70-72°C | |
| Name | 1,1,1,3,5,5,5-Heptafluoropentane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 70-72°C |
| Molecular Formula | C5HF7O2 |
| Molecular Weight | 226.04900 |
| Flash Point | 70-72°C |
| Exact Mass | 225.98600 |
| PSA | 34.14000 |
| LogP | 1.58730 |
| Index of Refraction | 1.329 |
| InChIKey | GRHYFDZMGZYXAP-UHFFFAOYSA-N |
| SMILES | O=C(C(F)C(=O)C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3265 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00153187 |
| 1,1,1,3,5,5,5-heptafluoropentane-2,4-dione |