(r)-4-nitromandelic acid structure
|
Common Name | (r)-4-nitromandelic acid | ||
|---|---|---|---|---|
| CAS Number | 77977-73-2 | Molecular Weight | 197.14500 | |
| Density | 1.552g/cm3 | Boiling Point | 436.4ºC at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.6ºC | |
| Name | (r)-4-nitromandelic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.552g/cm3 |
|---|---|
| Boiling Point | 436.4ºC at 760 mmHg |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.14500 |
| Flash Point | 197.6ºC |
| Exact Mass | 197.03200 |
| PSA | 103.35000 |
| LogP | 1.23600 |
| Index of Refraction | 1.634 |
| InChIKey | ZSMJZVLXJDNZHG-SSDOTTSWSA-N |
| SMILES | O=C(O)C(O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2918199090 |
|---|
|
~%
(r)-4-nitromand... CAS#:77977-73-2 |
| Literature: Hoover; Dunn; Jakas; Lam; Taggart; Guarini; Phillips Journal of Medicinal Chemistry, 1974 , vol. 17, # 1 p. 34 - 41 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-nitro-D-mandelic acid |
| 4-Nitro-D-mandelsaeure |