Benzeneacetic acid, a-hydroxy-4-nitro structure
|
Common Name | Benzeneacetic acid, a-hydroxy-4-nitro | ||
|---|---|---|---|---|
| CAS Number | 10098-39-2 | Molecular Weight | 197.14500 | |
| Density | 1.552g/cm3 | Boiling Point | 436.4ºC at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.5ºC | |
| Name | 2-hydroxy-2-(4-nitrophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.552g/cm3 |
|---|---|
| Boiling Point | 436.4ºC at 760 mmHg |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.14500 |
| Flash Point | 197.5ºC |
| Exact Mass | 197.03200 |
| PSA | 103.35000 |
| LogP | 1.23600 |
| Vapour Pressure | 2.17E-08mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | ZSMJZVLXJDNZHG-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2918199090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-nitromandelic acid |
| 4-nitro-DL-mandelic acid |
| 4-Nitro-DL-mandelsaeure |
| Hydroxy(4-nitrophenyl)acetic acid |
| 4-Nitrophenylglycolic acid |
| (4-nitrophenyl)(hydroxy)acetic acid |
| 4-nitro-mandelic acid |