methyl 2,5-dichlorobenzenesulphonate structure
|
Common Name | methyl 2,5-dichlorobenzenesulphonate | ||
|---|---|---|---|---|
| CAS Number | 78150-04-6 | Molecular Weight | 241.09200 | |
| Density | 1.493g/cm3 | Boiling Point | 342.9ºC at 760 mmHg | |
| Molecular Formula | C7H6Cl2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.2ºC | |
| Name | methyl 2,5-dichlorobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.493g/cm3 |
|---|---|
| Boiling Point | 342.9ºC at 760 mmHg |
| Molecular Formula | C7H6Cl2O3S |
| Molecular Weight | 241.09200 |
| Flash Point | 161.2ºC |
| Exact Mass | 239.94100 |
| PSA | 51.75000 |
| LogP | 3.40930 |
| Index of Refraction | 1.551 |
| InChIKey | LPOZFGQJZQYOBJ-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)c1cc(Cl)ccc1Cl |
| HS Code | 2905199090 |
|---|
|
~76%
methyl 2,5-dich... CAS#:78150-04-6 |
| Literature: Lewis, Edward S.; Smith, Michael J.; Christie, J. Joseph Journal of Organic Chemistry, 1983 , vol. 48, # 15 p. 2527 - 2531 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2905199090 |
|---|---|
| Summary | 2905199090. saturated monohydric alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Methyldichlorobenzene sulfonate |
| Benzenesulfonic acid,2,5-dichloro-,methyl ester |
| Methyl 2,5-dichlorobenzenesulphonate |