2,5-DICHLOROBENZENESULFONYL CHLORIDE structure
|
Common Name | 2,5-DICHLOROBENZENESULFONYL CHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 5402-73-3 | Molecular Weight | 245.51100 | |
| Density | 1.636 g/cm3 | Boiling Point | 327.6ºC at 760 mmHg | |
| Molecular Formula | C6H3Cl3O2S | Melting Point | 36-37 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2,5-dichlorobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.636 g/cm3 |
|---|---|
| Boiling Point | 327.6ºC at 760 mmHg |
| Melting Point | 36-37 °C(lit.) |
| Molecular Formula | C6H3Cl3O2S |
| Molecular Weight | 245.51100 |
| Flash Point | >230 °F |
| Exact Mass | 243.89200 |
| PSA | 42.52000 |
| LogP | 4.00170 |
| Index of Refraction | 1.581 |
| InChIKey | BXCOSWRSIISQSL-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cc(Cl)ccc1Cl |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S27-S28-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~%
2,5-DICHLOROBEN... CAS#:5402-73-3 |
| Literature: Journal of the Chemical Society, , vol. 121, p. 2558 |
|
~%
2,5-DICHLOROBEN... CAS#:5402-73-3 |
| Literature: Doklady Akademii Nauk SSSR, , vol. 112, p. 872,873 Doklady Chemistry, 112-117 <1957> 133, 134 Zhurnal Obshchei Khimii, , vol. 28, p. 184; engl.Ausg.S.185 |
|
~%
2,5-DICHLOROBEN... CAS#:5402-73-3 |
| Literature: J. Appl. Chem. USSR (Engl. Transl.), , vol. 53, # 10 p. 2298 - 2302,1748 - 1752 |
|
~%
2,5-DICHLOROBEN... CAS#:5402-73-3 |
| Literature: Monatshefte fuer Chemie, , vol. 48, p. 632 Journal of the Chemical Society, , vol. 121, p. 2558 |
|
~%
Detail
|
| Literature: Doklady Akademii Nauk SSSR, , vol. 112, p. 872,873 Doklady Chemistry, 112-117 <1957> 133, 134 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Benzoxazole benzenesulfonamides as allosteric inhibitors of fructose-1,6-bisphosphatase.
Bioorg. Med. Chem. Lett. 16 , 1807, (2006) A series of novel benzoxazole benzenesulfonamides was synthesized as inhibitors of fructose-1,6-bisphosphatase (FBPase-1). Extensive SAR studies led to a potent inhibitor, 53, with an IC(50) of 0.57mi... |
| Benzenesulfonyl chloride,2,5-dichloro |
| 2,4-DICYANOBENZOTRIFLUORIDE |
| 2,5-Dichlorobenzene-1-sulfonyl chloride |
| MFCD00007429 |
| 2,5-Dichlorobenzenesulfonyl chloride |
| 2,5-dichlorobenzenesulfochloride |
| 2,5-Dichlorobenzenesulphonyl chloride |
| EINECS 226-453-6 |
| 2,5-dichloro-benzenesulfonyl chloride |