(3R,6S)-3-amino-6-(2,3-difluorophenyl)-1-(2,2,2-trifluoroethyl)azepan-2-one structure
|
Common Name | (3R,6S)-3-amino-6-(2,3-difluorophenyl)-1-(2,2,2-trifluoroethyl)azepan-2-one | ||
|---|---|---|---|---|
| CAS Number | 781650-41-7 | Molecular Weight | 322.274 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 367.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H15F5N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1±27.9 °C | |
| Name | (3R,6S)-3-amino-6-(2,3-difluorophenyl)-1-(2,2,2-trifluoroethyl)azepan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 367.6±42.0 °C at 760 mmHg |
| Molecular Formula | C14H15F5N2O |
| Molecular Weight | 322.274 |
| Flash Point | 176.1±27.9 °C |
| Exact Mass | 322.110443 |
| PSA | 46.33000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | COZIJLDLJMKBRZ-LDYMZIIASA-N |
| SMILES | NC1CCC(c2cccc(F)c2F)CN(CC(F)(F)F)C1=O |
|
~79%
(3R,6S)-3-amino... CAS#:781650-41-7 |
| Literature: Palucki, Michael; Davies, Ian; Steinbuebel, Dietrich; Rosen, Jonathan Patent: US2009/124799 A1, 2009 ; Location in patent: Page/Page column 4; 13 ; US 20090124799 A1 |
|
~%
(3R,6S)-3-amino... CAS#:781650-41-7 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
|
~%
(3R,6S)-3-amino... CAS#:781650-41-7 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
|
~%
(3R,6S)-3-amino... CAS#:781650-41-7 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
|
~%
(3R,6S)-3-amino... CAS#:781650-41-7 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
|
~%
(3R,6S)-3-amino... CAS#:781650-41-7 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
|
~%
(3R,6S)-3-amino... CAS#:781650-41-7 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
|
~%
(3R,6S)-3-amino... CAS#:781650-41-7 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
| (3R,6S)-3-Amino-6-(2,3-difluorophenyl)-1-(2,2,2-trifluoroethyl)-2-azepanone |
| (3R,6S)-3-Amino-6-(2,3-difluorphenyl)-1-(2,2,2-trifluorethyl)azepan-2-on |
| 2H-Azepin-2-one, 3-amino-6-(2,3-difluorophenyl)hexahydro-1-(2,2,2-trifluoroethyl)-, (3R,6S)- |
| (3R,6S)-3-amino-6-(2,3-difluorophenyl)-1-(2,2,2-trifluoroethyl)azepan-2-one |