Benzyl (2R,5E)-2-(bis{[(2-methyl-2-propanyl)oxy]carbonyl}amino)-6 -nitro-5-hexenoate structure
|
Common Name | Benzyl (2R,5E)-2-(bis{[(2-methyl-2-propanyl)oxy]carbonyl}amino)-6 -nitro-5-hexenoate | ||
|---|---|---|---|---|
| CAS Number | 784156-33-8 | Molecular Weight | 464.50900 | |
| Density | 1.177g/cm3 | Boiling Point | 557.5ºC at 760 mmHg | |
| Molecular Formula | C23H32N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291ºC | |
| Name | Benzyl (2R,5E)-2-(bis{[(2-methyl-2-propanyl)oxy]carbonyl}amino)-6 -nitro-5-hexenoate |
|---|
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 557.5ºC at 760 mmHg |
| Molecular Formula | C23H32N2O8 |
| Molecular Weight | 464.50900 |
| Flash Point | 291ºC |
| Exact Mass | 464.21600 |
| PSA | 127.96000 |
| LogP | 5.36440 |
| Index of Refraction | 1.522 |
| InChIKey | YCJBPXOBGPPBFD-HAZIXKIPSA-N |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C(CCC=C[N+](=O)[O-])C(=O)OCc1ccccc1 |
|
~68%
Benzyl (2R,5E)-... CAS#:784156-33-8 |
| Literature: MERCK and CO., INC. Patent: WO2006/41830 A2, 2006 ; Location in patent: Page/Page column 67 ; WO 2006/041830 A2 |
|
~71%
Benzyl (2R,5E)-... CAS#:784156-33-8 |
| Literature: MERCK and CO., INC. Patent: WO2006/47196 A2, 2006 ; Location in patent: Page/Page column 57-58 ; WO 2006/047196 A2 |
|
~%
Benzyl (2R,5E)-... CAS#:784156-33-8 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
|
~%
Benzyl (2R,5E)-... CAS#:784156-33-8 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
|
~%
Benzyl (2R,5E)-... CAS#:784156-33-8 |
| Literature: MERCK and CO., INC. Patent: WO2008/153849 A1, 2008 ; WO 2008/153849 A1 |
| Precursor 6 | |
|---|---|
| DownStream 4 | |