2-(4-Fluorophenyl) indole structure
|
Common Name | 2-(4-Fluorophenyl) indole | ||
|---|---|---|---|---|
| CAS Number | 782-17-2 | Molecular Weight | 211.234 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 389.1±17.0 °C at 760 mmHg | |
| Molecular Formula | C14H10FN | Melting Point | 188-191 °C(lit.) | |
| MSDS | N/A | Flash Point | 189.1±20.9 °C | |
| Name | 6-(4-Fluorophenyl)Indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.1±17.0 °C at 760 mmHg |
| Melting Point | 188-191 °C(lit.) |
| Molecular Formula | C14H10FN |
| Molecular Weight | 211.234 |
| Flash Point | 189.1±20.9 °C |
| Exact Mass | 211.079727 |
| PSA | 15.79000 |
| LogP | 4.61 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | VLHGDCJIDNVRFM-UHFFFAOYSA-N |
| SMILES | Fc1ccc(-c2cc3ccccc3[nH]2)cc1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-Fluorophenyl) indole |
| 2-(4-Fluorophenyl)-1H-indole |
| 1H-Indole, 2-(4-fluorophenyl)- |
| MFCD00800376 |