2-(5-methoxy-2-nitroanilino)ethanol structure
|
Common Name | 2-(5-methoxy-2-nitroanilino)ethanol | ||
|---|---|---|---|---|
| CAS Number | 78213-34-0 | Molecular Weight | 212.20300 | |
| Density | 1.336g/cm3 | Boiling Point | 437.9ºC at 760 mmHg | |
| Molecular Formula | C9H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.7ºC | |
| Name | 2-(5-methoxy-2-nitroanilino)ethanol |
|---|
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 437.9ºC at 760 mmHg |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20300 |
| Flash Point | 218.7ºC |
| Exact Mass | 212.08000 |
| PSA | 87.31000 |
| LogP | 1.60380 |
| Index of Refraction | 1.612 |
| InChIKey | TXKCTQZGCPFJCM-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(NCCO)c1 |
|
~%
2-(5-methoxy-2-... CAS#:78213-34-0 |
| Literature: ACTELION PHARMACEUTICALS LTD; BOLLI, Martin; BOSS, Christoph; BROTSCHI, Christine; GUDE, Markus; HEIDMANN, Bibia; SIFFERLEN, Thierry; WILLIAMS, Jodi, T. Patent: WO2012/110986 A1, 2012 ; Location in patent: Page/Page column 54 ; WO 2012/110986 A1 |
|
~71%
2-(5-methoxy-2-... CAS#:78213-34-0 |
| Literature: Hoang, Hung; Huang, Xiaofen; Skibo, Edward B. Organic and Biomolecular Chemistry, 2008 , vol. 6, # 17 p. 3059 - 3064 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |