3-Hydroxy-5-nitrobenzoic acid structure
|
Common Name | 3-Hydroxy-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 78238-14-9 | Molecular Weight | 183.118 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 423.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H5NO5 | Melting Point | 190-195ºC | |
| MSDS | Chinese USA | Flash Point | 195.3±15.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Hydroxy-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 423.5±40.0 °C at 760 mmHg |
| Melting Point | 190-195ºC |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.118 |
| Flash Point | 195.3±15.8 °C |
| Exact Mass | 183.016769 |
| PSA | 103.35000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | ZVLLYIMPDTXFNC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(O)cc([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918290000 |
|
~96%
3-Hydroxy-5-nit... CAS#:78238-14-9 |
| Literature: Hartung, Ingo V.; Rude, Mathew A.; Schnarr, Nathan A.; Hunziker, Daniel; Khosla, Chaitan Journal of the American Chemical Society, 2005 , vol. 127, # 32 p. 11202 - 11203 |
|
~%
3-Hydroxy-5-nit... CAS#:78238-14-9 |
| Literature: Journal of the American Chemical Society, , vol. 127, # 32 p. 11202 - 11203 |
|
~44%
3-Hydroxy-5-nit... CAS#:78238-14-9 |
| Literature: Wang, Ying; Xiang, Junfeng; Jiang, Hua Chemistry - A European Journal, 2011 , vol. 17, # 2 p. 613 - 619 |
|
~78%
3-Hydroxy-5-nit... CAS#:78238-14-9 |
| Literature: Herlt, Anthony J.; Kibby, Jeffrey J.; Rickards, Rodney W. Australian Journal of Chemistry, 1981 , vol. 34, # 6 p. 1319 - 1324 |
|
~%
3-Hydroxy-5-nit... CAS#:78238-14-9 |
| Literature: Australian Journal of Chemistry, , vol. 34, # 6 p. 1319 - 1324 |
| Precursor 5 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 3-Hydroxy-5-nitro-benzoesaeure |
| 3-nitro-5-hydroxy-benzoic acid |
| 5-hydroxy-3-nitrobenzoic acid |
| 3-hydroxy-5-nitro-benzoic acid |
| 3-Hydroxy-5-nitrobenzoic acid |
| Benzoic acid, 3-hydroxy-5-nitro- |
| 3-Hydroxy-5-nitrobenzoicacid |