1-(2-(trimethylsilyl)ethoxycarbonyloxy)& structure
|
Common Name | 1-(2-(trimethylsilyl)ethoxycarbonyloxy)& | ||
|---|---|---|---|---|
| CAS Number | 78269-85-9 | Molecular Weight | 259.331 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 308.6±44.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO5Si | Melting Point | 83-88ºC(lit.) | |
| MSDS | USA | Flash Point | 140.4±28.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-Dioxopyrrolidin-1-yl (2-(trimethylsilyl)ethyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.6±44.0 °C at 760 mmHg |
| Melting Point | 83-88ºC(lit.) |
| Molecular Formula | C10H17NO5Si |
| Molecular Weight | 259.331 |
| Flash Point | 140.4±28.4 °C |
| Exact Mass | 259.087585 |
| PSA | 72.91000 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | FLDNDAMSCINJDX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOC(=O)ON1C(=O)CCC1=O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~82%
1-(2-(trimethyl... CAS#:78269-85-9 |
| Literature: GILEAD SCIENCES, INC. Patent: WO2008/11117 A2, 2008 ; Location in patent: Page/Page column 491 ; WO 2008/011117 A2 |
|
~79%
1-(2-(trimethyl... CAS#:78269-85-9 |
| Literature: LEAD Therapeutics, Inc. Patent: US2010/105607 A1, 2010 ; US 20100105607 A1 |
|
~%
1-(2-(trimethyl... CAS#:78269-85-9 |
| Literature: Synthesis, , # 4 p. 346 - 349 |
|
~%
1-(2-(trimethyl... CAS#:78269-85-9 |
| Literature: Synthesis, , # 4 p. 346 - 349 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Synthesis and evaluation of novel activated mixed carbonate reagents for the introduction of the 2-(trimethylsilyl) ethoxycarbonyl (Teoc)-protecting group. Shute RE and Rich DH
Synthesis 1987(04 ) , 346-349, (1987)
|
| MFCD02683467 |
| 1-({[2-(Trimethylsilyl)ethoxy]carbonyl}oxy)-2,5-pyrrolidinedione |
| (2,5-dioxopyrrolidin-1-yl) 2-trimethylsilylethyl carbonate |
| 2,5-Pyrrolidinedione, 1-[[[2-(trimethylsilyl)ethoxy]carbonyl]oxy]- |
| 1-({[2-(Trimethylsilyl)ethoxy]carbonyl}oxy)pyrrolidine-2,5-dione |