tert-Butyl(dimethyl)silyl 3-phenylpropanoate structure
|
Common Name | tert-Butyl(dimethyl)silyl 3-phenylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 78324-01-3 | Molecular Weight | 264.43500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [tert-butyl(dimethyl)silyl] 3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24O2Si |
|---|---|
| Molecular Weight | 264.43500 |
| Exact Mass | 264.15500 |
| PSA | 26.30000 |
| LogP | 4.16760 |
| InChIKey | DMEANXAVVZKYTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)CCc1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~81%
tert-Butyl(dime... CAS#:78324-01-3 |
| Literature: Kita, Yasuyuki; Haruta, Jun-ichi; Fujii, Takehiko; Segawa, Jun; Tamura, Yasumitsu Synthesis, 1981 , # 6 p. 451 - 452 |
|
~%
tert-Butyl(dime... CAS#:78324-01-3 |
| Literature: Yamamoto, Keiji; Takemae, Makoto Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 6 p. 2111 - 2113 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzenepropanoic acid,tert-butyldimethylsilyl ester |
| 3-phenylpropionic acid |
| t-butyldimethylsilyl 3-phenylpropionate |
| t-butyldimethylsilyl ester |
| 3-phenylpropionic acid,t-butyldimethylsilyl ester |