1H-anthra[2,3-d]triazole-5,10-dione structure
|
Common Name | 1H-anthra[2,3-d]triazole-5,10-dione | ||
|---|---|---|---|---|
| CAS Number | 78324-76-2 | Molecular Weight | 249.22400 | |
| Density | 1.577g/cm3 | Boiling Point | 590.9ºC at 760mmHg | |
| Molecular Formula | C14H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.8ºC | |
| Name | 2H-naphtho[3,2-f]benzotriazole-5,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.577g/cm3 |
|---|---|
| Boiling Point | 590.9ºC at 760mmHg |
| Molecular Formula | C14H7N3O2 |
| Molecular Weight | 249.22400 |
| Flash Point | 298.8ºC |
| Exact Mass | 249.05400 |
| PSA | 75.71000 |
| LogP | 1.73330 |
| Index of Refraction | 1.793 |
| InChIKey | LSBFHEKUKJOTOI-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2cc3n[nH]nc3cc21 |
| HS Code | 2933990090 |
|---|
|
~%
1H-anthra[2,3-d... CAS#:78324-76-2 |
| Literature: Waldmann; Hindenburg Chemische Berichte, 1938 , vol. 71, p. 371 |
|
~%
1H-anthra[2,3-d... CAS#:78324-76-2 |
| Literature: Bayer and Co. Patent: DE254745 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 648 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 278-895-4 |