9,10-Anthracenedione,2,3-diamino- structure
|
Common Name | 9,10-Anthracenedione,2,3-diamino- | ||
|---|---|---|---|---|
| CAS Number | 605-22-1 | Molecular Weight | 238.24100 | |
| Density | 1.456g/cm3 | Boiling Point | 551.9ºC at 760mmHg | |
| Molecular Formula | C14H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.6ºC | |
| Name | 2,3-diaminoanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 551.9ºC at 760mmHg |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.24100 |
| Flash Point | 287.6ºC |
| Exact Mass | 238.07400 |
| PSA | 86.18000 |
| LogP | 2.78880 |
| Index of Refraction | 1.757 |
| InChIKey | QLYNDPSMXHPWNH-UHFFFAOYSA-N |
| SMILES | Nc1cc2c(cc1N)C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
9,10-Anthracene... CAS#:605-22-1 |
| Literature: I. G. Farbenind. Patent: DE607539 , 1933 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 21, p. 1040 |
|
~%
9,10-Anthracene... CAS#:605-22-1 |
| Literature: Ges. f. chem. Ind. Basel Patent: DE480848 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1211 |
|
~%
9,10-Anthracene... CAS#:605-22-1 |
| Literature: Bayer and Co. Patent: DE167410 ; |
|
~%
9,10-Anthracene... CAS#:605-22-1 |
| Literature: Bayer and Co. Patent: DE167410 ; |
|
~%
9,10-Anthracene... CAS#:605-22-1 |
| Literature: Bayer and Co. Patent: DE167410 ; |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,3-Diaminoanthrachinon |
| 9,2,3-diamino |
| 2,3-diamino-9,10-anthracenedione |
| 9,10-Anthracenedione,2,3-diamino |
| 1.2-Diamino-anthrachinon |
| 2,3-Diamino-9,10-anthraquinone |
| 2,3-diamino-anthraquinone |