Methyl 8-iodo-4,5,6,7-tetramethoxy-2-naphthoate structure
|
Common Name | Methyl 8-iodo-4,5,6,7-tetramethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 78395-67-2 | Molecular Weight | 432.20700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17IO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 8-iodo-4,5,6,7-tetramethoxy-2-naphthoate |
|---|
| Molecular Formula | C16H17IO6 |
|---|---|
| Molecular Weight | 432.20700 |
| Exact Mass | 432.00700 |
| PSA | 63.22000 |
| LogP | 3.26540 |
| InChIKey | NTBGQCRXLURSTG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(OC)c(OC)c(OC)c(I)c2c1 |
|
~67%
Methyl 8-iodo-4... CAS#:78395-67-2 |
| Literature: Cameron, Donald W.; Feutrill, Geoffrey I.; Pannan, Linda J. H.; Raston, Colin L.; Skelton, Brian W.; White, Allan H. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1981 , p. 610 - 627 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |