1,1'-Biphenyl,2,3,4,5,6-pentafluoro- structure
|
Common Name | 1,1'-Biphenyl,2,3,4,5,6-pentafluoro- | ||
|---|---|---|---|---|
| CAS Number | 784-14-5 | Molecular Weight | 244.16000 | |
| Density | 1.389g/cm3 | Boiling Point | 229.1ºC at 760 mmHg | |
| Molecular Formula | C12H5F5 | Melting Point | 111-113°C | |
| MSDS | N/A | Flash Point | 80.5ºC | |
| Name | 2,3,4,5,6-Pentafluorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 229.1ºC at 760 mmHg |
| Melting Point | 111-113°C |
| Molecular Formula | C12H5F5 |
| Molecular Weight | 244.16000 |
| Flash Point | 80.5ºC |
| Exact Mass | 244.03100 |
| LogP | 4.04910 |
| Index of Refraction | 1.489 |
| InChIKey | BEKHDAJTCOSDPJ-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(-c2ccccc2)c(F)c1F |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 212-316-8 |
| 2,3,4,5,6-pentafluorobiphenyl |
| MFCD00093108 |