3-nitroso-2-phenyl-1H-indole
3-nitroso-2-phenyl-1H-indole structure
|
Common Name | 3-nitroso-2-phenyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 784-45-2 | Molecular Weight | 222.24200 | |
| Density | 1.24g/cm3 | Boiling Point | 467.4ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-nitroso-2-phenyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 467.4ºC at 760 mmHg |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.24200 |
| Flash Point | 236.5ºC |
| Exact Mass | 222.07900 |
| PSA | 45.22000 |
| LogP | 4.23280 |
| Index of Refraction | 1.663 |
| InChIKey | OKRIMXDIYQGPBU-UHFFFAOYSA-N |
| SMILES | O=Nc1c(-c2ccccc2)[nH]c2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
3-nitroso-2-phe... CAS#:784-45-2 |
| Literature: Inotek Pharmaceutical, Corp. Patent: US2006/19980 A1, 2006 ; Location in patent: Page/Page column 37; 55 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 4 | |
CAS#:23041-45-4
CAS#:2989-63-1
CAS#:6339-33-9
CAS#:40288-69-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Nitroso-2-phenyl-imidazo<1,2-a>pyrimidin |
| 3-Nitroso-2-phenyl-indol |
| 3-nitroso-2-phenyl indole |
| 2-Phenyl-3-nitroso-imidazo<1,2-a>pyrimidin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-nitroso-2-phenyl-1H-indole? |
| A: Molecular weight of 3-nitroso-2-phenyl-1H-indole is 222.24200. |
| Q: What is the molecular formula of 3-nitroso-2-phenyl-1H-indole? |
| A: Molecular formula of 3-nitroso-2-phenyl-1H-indole is C14H10N2O. |
| Q: What is the LogP of 3-nitroso-2-phenyl-1H-indole? |
| A: LogP of 3-nitroso-2-phenyl-1H-indole is 4.23280. |
| Q: What is the SMILES notation of 3-nitroso-2-phenyl-1H-indole? |
| A: SMILES notation of 3-nitroso-2-phenyl-1H-indole is O=Nc1c(-c2ccccc2)[nH]c2ccccc12. |
| Q: What is the Chinese name of 784-45-2? |
| A: Chinese name of 784-45-2 is 784-45-2. |
| Q: What English synonyms does 3-nitroso-2-phenyl-1H-indole have? |
| A: English synonyms of 3-nitroso-2-phenyl-1H-indole: 3-Nitroso-2-phenyl-imidazopyrimidin, 3-Nitroso-2-phenyl-indol, 3-nitroso-2-phenyl indole, 2-Phenyl-3-nitroso-imidazopyrimidin. |
| Q: What is the polar surface area (PSA) of 3-nitroso-2-phenyl-1H-indole? |
| A: Polar surface area (PSA) of 3-nitroso-2-phenyl-1H-indole is 45.22000. |
| Q: What is the InChIKey of 3-nitroso-2-phenyl-1H-indole? |
| A: InChIKey of 3-nitroso-2-phenyl-1H-indole is OKRIMXDIYQGPBU-UHFFFAOYSA-N. |
| Q: What are the downstream products of 3-nitroso-2-phenyl-1H-indole? |
| A: Related downstream products(CAS) of 3-nitroso-2-phenyl-1H-indole: 23041-45-4;2989-63-1;6339-33-9;40288-69-5. |
| Q: What is the CAS number of 3-nitroso-2-phenyl-1H-indole? |
| A: CAS number of 3-nitroso-2-phenyl-1H-indole is 784-45-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |