2-Phenylindole structure
|
Common Name | 2-Phenylindole | ||
|---|---|---|---|---|
| CAS Number | 948-65-2 | Molecular Weight | 193.244 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 419.9±0.0 °C at 760 mmHg | |
| Molecular Formula | C14H11N | Melting Point | 188-190 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 176.6±11.9 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-Phenylindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.9±0.0 °C at 760 mmHg |
| Melting Point | 188-190 °C(lit.) |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.244 |
| Flash Point | 176.6±11.9 °C |
| Exact Mass | 193.089142 |
| PSA | 15.79000 |
| LogP | 4.68 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | KLLLJCACIRKBDT-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2cc3ccccc3[nH]2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335-H413 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R37/38;R41 |
| Safety Phrases | S26-S39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | NM1272500 |
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Melatonin-mediated Bim up-regulation and cyclooxygenase-2 (COX-2) down-regulation enhances tunicamycin-induced apoptosis in MDA-MB-231 cells.
J. Pineal Res. 58(3) , 310-20, (2015) Melatonin is involved in many physiological functions, and it has differential effects on apoptosis in normal and cancer cells. However, the mechanism of its antitumor roles is not well understood. In... |
|
|
The Drosophila MAPK p38c regulates oxidative stress and lipid homeostasis in the intestine.
PLoS Genet. 10(9) , e1004659, (2014) The p38 mitogen-activated protein (MAP) kinase signaling cassette has been implicated in stress and immunity in evolutionarily diverse species. In response to a wide variety of physical, chemical and ... |
|
|
Kuwanon V inhibits proliferation, promotes cell survival and increases neurogenesis of neural stem cells.
PLoS ONE 10(2) , e0118188, (2015) Neural stem cells (NSCs) have the ability to proliferate and differentiate into neurons and glia. Regulation of NSC fate by small molecules is important for the generation of a certain type of cell. T... |
| 1H-Indole, 2-phenyl- |
| EINECS 213-436-3 |
| MFCD00005608 |
| 2-Phenyl-1H-indole |
| A-PHENYLINDOL |
| 2-phenyl-indol |
| a-Phenylindole |
| Indole,2-phenyl |
| 2-pPhenyl-1H-indole |
| 2-phenyl-1h-indol |
| 2-Phenylindole |
| Stabilizer I |
| 2-phenyl-indole |