2-Naphthalenebutanoicacid, 5,6,7,8-tetrahydro-g-oxo- structure
|
Common Name | 2-Naphthalenebutanoicacid, 5,6,7,8-tetrahydro-g-oxo- | ||
|---|---|---|---|---|
| CAS Number | 785-17-1 | Molecular Weight | 232.27500 | |
| Density | N/A | Boiling Point | 464.3ºC at 760 mmHg | |
| Molecular Formula | C14H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.7ºC | |
| Name | 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 464.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.27500 |
| Flash Point | 248.7ºC |
| Exact Mass | 232.11000 |
| PSA | 54.37000 |
| LogP | 2.61290 |
| InChIKey | KTIOSKUXBNFTFX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc2c(c1)CCCC2 |
| HS Code | 2918300090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-oxo-4-(5,6,7,8-tetrahydro-naphthalen-2-yl)-butyric acid |
| Propionic acid,6,7,8-tetrahydro-2-naphthoyl) |
| 4-Oxo-4-(5,6,7,8-tetrahydro-[2]naphthyl)-buttersaeure |
| 4-oxo-4-(5,6,7,8-tetrahydro-[2]naphthyl)-butyric acid |