N-(tert-Butoxycarbonyl)-3-(2-thienyl)-DL-alanine structure
|
Common Name | N-(tert-Butoxycarbonyl)-3-(2-thienyl)-DL-alanine | ||
|---|---|---|---|---|
| CAS Number | 78512-39-7 | Molecular Weight | 271.333 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 431.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.8±27.3 °C | |
| Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.5±40.0 °C at 760 mmHg |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.333 |
| Flash Point | 214.8±27.3 °C |
| Exact Mass | 271.087830 |
| PSA | 103.87000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | OJLISTAWQHSIHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cccs1)C(=O)O |
| Storage condition | 2-8°C |
| HS Code | 2934999090 |
|---|
|
~97%
N-(tert-Butoxyc... CAS#:78512-39-7 |
| Literature: Lipkowski, Andrzej W.; Flouret, George Polish Journal of Chemistry, 1980 , vol. 54, # 11/12 p. 2225 - 2228 |
|
~%
N-(tert-Butoxyc... CAS#:78512-39-7 |
| Literature: Noe; Weigand; Pirker Monatshefte fur Chemie, 1996 , vol. 127, # 10 p. 1081 - 1097 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-((tert-Butoxycarbonyl)amino)-3-(thiophen-2-yl)propanoic acid |
| 2-tert-butoxycarbonylamino-3-thiophen-2-yl-propionic acid |
| 2-Thiophenepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| Nα-tert-Butoxycarbonyl-3-(2-thienyl)-DL-alanine |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-(2-thienyl)alanine |
| T5SJ B1YVQMVOX1&1&1 |
| Boc-3-(2-Thienyl)-DL-alanine |
| +-N-(tert-Butoxycarbonyl)-3-(2-thienyl)alanine |
| +-N-(tert-Butoxycarbonyl)-3-(thien-2-yl)alanine |
| α-[[(1,1-dimethylethoxy)carbonyl]amino]-2-thiophenepropanoic acid |
| N-(tert-Butoxycarbonyl)-3-(2-thienyl)-DL-alanine |