1-(2-azidophenyl)-3,5-dimethylpyrazole structure
|
Common Name | 1-(2-azidophenyl)-3,5-dimethylpyrazole | ||
|---|---|---|---|---|
| CAS Number | 78564-50-8 | Molecular Weight | 213.23900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-azidophenyl)-3,5-dimethylpyrazole |
|---|
| Molecular Formula | C11H11N5 |
|---|---|
| Molecular Weight | 213.23900 |
| Exact Mass | 213.10100 |
| PSA | 67.57000 |
| LogP | 2.88366 |
| InChIKey | JOFVMQNMOWGHJL-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(-c2ccccc2N=[N+]=[N-])n1 |
|
~71%
1-(2-azidopheny... CAS#:78564-50-8 |
| Literature: Albini, Angelo; Bettinetti, Gianfranco; Minoli, Giovanna Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 581 - 585 |
|
~%
1-(2-azidopheny... CAS#:78564-50-8 |
| Literature: Albini, Angelo; Bettinetti, Gian Franco; Minoli, Giovanna Chemistry Letters, 1981 , p. 331 - 334 |
|
~%
1-(2-azidopheny... CAS#:78564-50-8 |
| Literature: Albini, Angelo; Bettinetti, Gian Franco; Minoli, Giovanna Chemistry Letters, 1981 , p. 331 - 334 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |