3,5-dimethyl-1-(2-nitrosophenyl)pyrazole structure
|
Common Name | 3,5-dimethyl-1-(2-nitrosophenyl)pyrazole | ||
|---|---|---|---|---|
| CAS Number | 86100-00-7 | Molecular Weight | 201.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dimethyl-1-(2-nitrosophenyl)pyrazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11N3O |
|---|---|
| Molecular Weight | 201.22500 |
| Exact Mass | 201.09000 |
| PSA | 47.25000 |
| LogP | 2.88700 |
| InChIKey | PXKRCZSQYLXMLZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(-c2ccccc2N=O)n1 |
|
~%
3,5-dimethyl-1-... CAS#:86100-00-7 |
| Literature: Albini, Angelo; Bettinetti, Gianfranco; Minoli, Giovanna Journal of the American Chemical Society, 1999 , vol. 121, # 13 p. 3104 - 3113 |
| 1H-Pyrazole,3,5-dimethyl-1-(2-nitrosophenyl) |