4,5,6,7-tetrafluoro-3H-1,3-benzothiazole-2-thione structure
|
Common Name | 4,5,6,7-tetrafluoro-3H-1,3-benzothiazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 786657-51-0 | Molecular Weight | 239.21300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7HF4NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5,6,7-tetrafluoro-3H-1,3-benzothiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7HF4NS2 |
|---|---|
| Molecular Weight | 239.21300 |
| Exact Mass | 238.94900 |
| PSA | 79.93000 |
| LogP | 3.14140 |
| InChIKey | AVWSRQLOHNLLTF-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c2sc(=S)[nH]c2c1F |
|
~%
4,5,6,7-tetrafl... CAS#:786657-51-0 |
| Literature: Silva, Gloria L.; Ediz, Volkan; Yaron, David; Armitage, Bruce A. Journal of the American Chemical Society, 2007 , vol. 129, # 17 p. 5710 - 5718 |
|
~86%
4,5,6,7-tetrafl... CAS#:786657-51-0 |
| Literature: Zhu, Lei; Zhang, Mingbao Journal of Organic Chemistry, 2004 , vol. 69, # 21 p. 7371 - 7374 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,5,6,7-tetrafluorobenzo[d]thiazole-2-thione |
| CTK2F9743 |
| 4,5,6,7-tetrafluoro-1,3-benzothiazole-2(3H)-thione |
| 2(3H)-Benzothiazolethione,4,5,6,7-tetrafluoro |
| 4,5,6,7-tetrafluoro-2(3H)-benzothiazolethione |