6-[(2,4,6-trimethylanilino)methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[(2,4,6-trimethylanilino)methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 787-94-0 | Molecular Weight | 239.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[(2,4,6-trimethylanilino)methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17NO |
|---|---|
| Molecular Weight | 239.31200 |
| Exact Mass | 239.13100 |
| PSA | 29.10000 |
| LogP | 3.67570 |
| InChIKey | GFXUGLRIJLPSQR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(N=Cc2ccccc2O)c(C)c1 |
|
~%
6-[(2,4,6-trime... CAS#:787-94-0 |
| Literature: Bulgarevich, S. B.; Polunin, A. A.; Movshovich, D. Ya.; Adamova, S. I.; Kogan, V. A.; Osipov, O. A. J. Gen. Chem. USSR (Engl. Transl.), 1981 , vol. 51, # 11 p. 2528 - 2531,2180 - 2182 |
|
~%
6-[(2,4,6-trime... CAS#:787-94-0 |
| Literature: Goyal; Singh Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, 2001 , vol. 40, # 6 p. 638 - 641 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-2,4,6-trimethylphenylsalicylaldimine |
| (2-Hydroxybenzaldehyd)-2,4,6-trimethylanil |
| 2,4,6-Trimethyl-N-salicyliden-anilin |
| salicylidene-(2,4,6-trimethyl-aniline) |
| 2-[(mesitylimino)methyl]phenol |
| HOC6H4CHNMes |
| AC1OA6O1 |
| 2-<2,4,6-Trimethyl-phenyliminomethyl>-phenol |