MOCPAC
Modify Date: 2025-09-21 12:06:20
MOCPAC structure
|
Common Name | MOCPAC | ||
|---|---|---|---|---|
| CAS Number | 787549-26-2 | Molecular Weight | 493.55 | |
| Density | 1.246g/cm3 | Boiling Point | 804.4ºC at 760 mmHg | |
| Molecular Formula | C27H31N3O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of MOCPACMOCPAC is an HDAC1 specific substrate[1]. |
| Name | benzyl N-[(2S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxo-6-(propanoylamino)hexan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | MOCPAC is an HDAC1 specific substrate[1]. |
|---|---|
| Related Catalog | |
| Target |
HDAC1 |
| References |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 804.4ºC at 760 mmHg |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.55 |
| Exact Mass | 493.22100 |
| PSA | 137.21000 |
| LogP | 5.72560 |
| Index of Refraction | 1.591 |
| InChIKey | BFDGUJKFQRJHJM-QFIPXVFZSA-N |
| SMILES | CCC(=O)NCCCCC(NC(=O)OCc1ccccc1)C(=O)Nc1ccc2c(C)cc(=O)oc2c1 |
| RIDADR | NONH for all modes of transport |
|---|
| phenylmethyl N-[(2S)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxo-6-(propanoylamino)hexan-2-yl]carbamate |
| Benzyl ((S)-[1-(4-methyl-2-oxo-2H-chromen-7-ylcarbamoyl)-5-propionylaminopentyl]carbamate |
| MOCPAC |