Methyl 5-(4-bromophenyl)-1H-pyrazole-3-carboxylate structure
|
Common Name | Methyl 5-(4-bromophenyl)-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 78842-74-7 | Molecular Weight | 281.105 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 465.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H9BrN2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 235.5±25.9 °C | |
| Name | methyl 3-(4-bromophenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 465.8±35.0 °C at 760 mmHg |
| Molecular Formula | C11H9BrN2O2 |
| Molecular Weight | 281.105 |
| Flash Point | 235.5±25.9 °C |
| Exact Mass | 279.984741 |
| PSA | 54.98000 |
| LogP | 2.91 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | IRKMOAWZRZMSCU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(-c2ccc(Br)cc2)n[nH]1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| f2130-0127 |
| 1H-Pyrazole-5-carboxylic acid, 3-(4-bromophenyl)-, methyl ester |
| Methyl 3-(4-bromophenyl)-1H-pyrazole-5-carboxylate |