Methyl 5-(2-bromophenyl)-1H-pyrazole-3-carboxylate structure
|
Common Name | Methyl 5-(2-bromophenyl)-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1035235-11-0 | Molecular Weight | 281.105 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 450.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.3±25.9 °C | |
| Name | Methyl 5-(2-bromophenyl)-1H-pyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 450.5±35.0 °C at 760 mmHg |
| Molecular Formula | C11H9BrN2O2 |
| Molecular Weight | 281.105 |
| Flash Point | 226.3±25.9 °C |
| Exact Mass | 279.984741 |
| PSA | 54.98000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | FZYWALYUEMDSIG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(-c2ccccc2Br)n[nH]1 |
| HS Code | 2933199090 |
|---|
|
~97%
Methyl 5-(2-bro... CAS#:1035235-11-0 |
| Literature: Millennium Pharmaceuticals, Inc. Patent: US2008/171754 A1, 2008 ; Location in patent: Page/Page column 97-98 ; US 20080171754 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazole-3-carboxylic acid, 5-(2-bromophenyl)-, methyl ester |
| methyl 3-(2-bromophenyl)-1H-pyrazole-5-carboxylate |
| Methyl 5-(2-bromophenyl)-1H-pyrazole-3-carboxylate |