CHEMBRDG-BB 6085090 structure
|
Common Name | CHEMBRDG-BB 6085090 | ||
|---|---|---|---|---|
| CAS Number | 78984-83-5 | Molecular Weight | 225.67100 | |
| Density | 1.208g/cm3 | Boiling Point | 427.5ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | N-[(4-chlorophenyl)methyl]-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 427.5ºC at 760 mmHg |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67100 |
| Flash Point | 212.4ºC |
| Exact Mass | 225.05600 |
| PSA | 46.17000 |
| LogP | 2.32620 |
| Index of Refraction | 1.536 |
| InChIKey | LWNOHVIQOGIHFD-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NCc1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
CHEMBRDG-BB 6085090 CAS#:78984-83-5 |
| Literature: Moreno, Elsa; Ancizu, Saioa; Perez-Silanes, Silvia; Torres, Enrique; Aldana, Ignacio; Monge, Antonio European Journal of Medicinal Chemistry, 2010 , vol. 45, # 10 p. 4418 - 4426 |
|
~%
CHEMBRDG-BB 6085090 CAS#:78984-83-5 |
| Literature: Hanefeld, Wolfgang; Glaeske, Gerd; Schulze-Weisschu, Petra Archiv der Pharmazie (Weinheim, Germany), 1981 , vol. 314, # 7 p. 587 - 594 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-4'-chlorobenzyl-3-oxobutanamide |