5-Amino-2-methyl-N-phenylbenzenesulfonamide structure
|
Common Name | 5-Amino-2-methyl-N-phenylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 79-72-1 | Molecular Weight | 262.328 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 467.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H14N2O2S | Melting Point | 42-50 °C(lit.) | |
| MSDS | N/A | Flash Point | 236.4±31.5 °C | |
| Name | 5-amino-2-methyl-N-phenylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.3±55.0 °C at 760 mmHg |
| Melting Point | 42-50 °C(lit.) |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.328 |
| Flash Point | 236.4±31.5 °C |
| Exact Mass | 262.077606 |
| PSA | 80.57000 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | HCAKHJQTCPZXPR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)cc1S(=O)(=O)Nc1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2935009090 |
|
~%
5-Amino-2-methy... CAS#:79-72-1 |
| Literature: WO2014/62511 A1, ; Page/Page column 184 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 5-Amino-2-toluenesulfonanilide |
| 5-amino-2-methyl-N-phenyl-benzenesulfonamide |
| 5-Amino-o-toluenesulfonanilide |
| 4-Aminotoluene-2-sulphonanilide |
| EINECS 201-221-7 |
| 4-amino-toluene-2-sulfonic acid anilide |
| o-Toluenesulfonanilide,5-amino |
| 5-Amino-2-methyl-N-phenylbenzenesulfonamide |
| MFCD00025372 |
| 4-AMINOTOLUENE-2-SULFONANILIDE |
| 5-Amino-ortho-toluenesulfonanilide |
| 4-Amino-toluol-2-sulfonsaeure-anilid |
| Benzenesulfonamide,5-amino-2-methyl-N-phenyl |