6-[3-[2-[2-[3-(3,8-diamino-5-methyl-6H-phenanthridin-6-yl)phenoxy]ethoxy]ethoxy]phenyl]-5-methyl-6H-phenanthridine-3,8-diamine structure
|
Common Name | 6-[3-[2-[2-[3-(3,8-diamino-5-methyl-6H-phenanthridin-6-yl)phenoxy]ethoxy]ethoxy]phenyl]-5-methyl-6H-phenanthridine-3,8-diamine | ||
|---|---|---|---|---|
| CAS Number | 79080-83-4 | Molecular Weight | 782.74700 | |
| Density | 1.28g/cm3 | Boiling Point | 997.5ºC at 760 mmHg | |
| Molecular Formula | C44H42BrN6O3+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 557.1ºC | |
| Name | 6-[3-[2-[2-[3-(3,8-diamino-5-methylphenanthridin-5-ium-6-yl)phenoxy]ethoxy]ethoxy]phenyl]-5-methylphenanthridin-5-ium-3,8-diamine,dibromide |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 997.5ºC at 760 mmHg |
| Molecular Formula | C44H42BrN6O3+ |
| Molecular Weight | 782.74700 |
| Flash Point | 557.1ºC |
| Exact Mass | 781.25000 |
| PSA | 139.53000 |
| LogP | 6.41440 |
| Index of Refraction | 1.697 |
| InChIKey | JIGNUYNMKSDSFL-UHFFFAOYSA-O |
| SMILES | C[n+]1c(-c2cccc(OCCOCCOc3cccc(-c4c5cc(N)ccc5c5ccc(N)cc5[n+]4C)c3)c2)c2cc(N)ccc2c2ccc(N)cc21.[Br-] |
|
~%
6-[3-[2-[2-[3-(... CAS#:79080-83-4 |
| Literature: Kuhlmann; Mosher Journal of Medicinal Chemistry, 1981 , vol. 24, # 11 p. 1333 - 1337 |
|
~%
6-[3-[2-[2-[3-(... CAS#:79080-83-4 |
| Literature: Kuhlmann; Mosher Journal of Medicinal Chemistry, 1981 , vol. 24, # 11 p. 1333 - 1337 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |