lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane
lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane structure
|
Common Name | lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 79101-69-2 | Molecular Weight | 284.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H29LiOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H29LiOSi |
|---|---|
| Molecular Weight | 284.43800 |
| Exact Mass | 284.21500 |
| PSA | 9.23000 |
| LogP | 5.48360 |
| InChIKey | ABHDOPHFIKQJRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1c[c-]cc(C(C)(C)C)c1O[Si](C)(C)C.[Li+] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
lithium,(2,6-di... CAS#:79101-69-2 |
| Literature: Grimm, Michael; Kirste, Burkhard; Kurreck, Harry Angewandte Chemie, 1986 , vol. 98, # 12 p. 1095 - 1099 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:2455-14-3![2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)-dimethylsilyl]phenol structure](https://image.chemsrc.com/caspic/219/120978-73-6.png)
CAS#:120978-73-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Lithium,[3,5-bis(1,1-dimethylethyl)-4-[(trimethylsilyl)oxy]phenyl] |
| lithium, (2,6-Di-tert-butyl-4-lithiophenoxy)trimethylsilane |
| 3,5-di-tert-butyl-4-trimethylsiloxyphenyllithium |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane? |
| A: Related upstream materials(CAS) of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane: 27329-74-4. |
| Q: What is the LogP of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane? |
| A: LogP of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane is 5.48360. |
| Q: What English synonyms does lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane have? |
| A: English synonyms of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane: Lithium,[3,5-bis(1,1-dimethylethyl)-4-[(trimethylsilyl)oxy]phenyl], lithium, (2,6-Di-tert-butyl-4-lithiophenoxy)trimethylsilane, 3,5-di-tert-butyl-4-trimethylsiloxyphenyllithium. |
| Q: What is the molecular formula of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane? |
| A: Molecular formula of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane is C17H29LiOSi. |
| Q: What is the Chinese name of 79101-69-2? |
| A: Chinese name of 79101-69-2 is 79101-69-2. |
| Q: What is the English name of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane? |
| A: The English name of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane is lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane. |
| Q: What is the InChIKey of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane? |
| A: InChIKey of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane is ABHDOPHFIKQJRC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane? |
| A: Molecular weight of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane is 284.43800. |
| Q: What is the CAS number of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane? |
| A: CAS number of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane is 79101-69-2. |
| Q: What is the polar surface area (PSA) of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane? |
| A: Polar surface area (PSA) of lithium,(2,6-ditert-butylbenzene-4-id-1-yl)oxy-trimethylsilane is 9.23000. |